Ciclofenazine structure
|
Common Name | Ciclofenazine | ||
|---|---|---|---|---|
| CAS Number | 17692-26-1 | Molecular Weight | 433.53300 | |
| Density | 1.291g/cm3 | Boiling Point | 536.6ºC at 760mmHg | |
| Molecular Formula | C23H26F3N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.3ºC | |
| Name | 10-[3-(4-cyclopropylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 536.6ºC at 760mmHg |
| Molecular Formula | C23H26F3N3S |
| Molecular Weight | 433.53300 |
| Flash Point | 278.3ºC |
| Exact Mass | 433.18000 |
| PSA | 35.02000 |
| LogP | 5.41900 |
| Vapour Pressure | 1.37E-11mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | NPYDSZQCCSLZPP-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCN1CCN(C3CC3)CC1)c1ccccc1S2 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-<3-(4-Cyclopropylpiperazino)-propyl>-2-trifluormethylphenthiazin |
| CICLOFENAZINE |
| Cyclophenazine hydrochloride |
| Ciclofenazine [INN] |
| 10H-Phenothiazine,10-[3-(4-cyclopropyl-1-piperazinyl)propyl]-2-(trifluoromethyl) |
| 10-[3-(4-cyclopropyl-piperazin-1-yl)-propyl]-2-trifluoromethyl-10H-phenothiazine |
| CYCLOPHENAZINE |