Floionolic acid
Modify Date: 2026-07-14 10:47:08
Floionolic acid structure
|
Common Name | Floionolic acid | ||
|---|---|---|---|---|
| CAS Number | 17705-68-9 | Molecular Weight | 332.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H36O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Floionolic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H36O5 |
|---|---|
| Molecular Weight | 332.5 |
| InChIKey | OISFHODBOQNZAG-IAGOWNOFSA-N |
| SMILES | O=C(O)CCCCCCCC(O)C(O)CCCCCCCCO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 17705-68-9? |
| A: Chinese name of 17705-68-9 is 17705-68-9. |
| Q: What is the SMILES notation of Floionolic acid? |
| A: SMILES notation of Floionolic acid is O=C(O)CCCCCCCC(O)C(O)CCCCCCCCO. |
| Q: What is the molecular weight of Floionolic acid? |
| A: Molecular weight of Floionolic acid is 332.5. |
| Q: What is the CAS number of Floionolic acid? |
| A: CAS number of Floionolic acid is 17705-68-9. |
| Q: What is the InChIKey of Floionolic acid? |
| A: InChIKey of Floionolic acid is OISFHODBOQNZAG-IAGOWNOFSA-N. |
| Q: What is the English name of Floionolic acid? |
| A: The English name of Floionolic acid is Floionolic acid. |
| Q: What is the molecular formula of Floionolic acid? |
| A: Molecular formula of Floionolic acid is C18H36O5. |