3-(Trimethylsilyl)phenylboronic acid structure
|
Common Name | 3-(Trimethylsilyl)phenylboronic acid | ||
|---|---|---|---|---|
| CAS Number | 177171-16-3 | Molecular Weight | 194.111 | |
| Density | 1.01 | Boiling Point | 290 ºC | |
| Molecular Formula | C9H15BO2Si | Melting Point | 138-140 ºC | |
| MSDS | Chinese USA | Flash Point | 129 ºC | |
| Name | 3-Trimethylsilylphenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01 |
|---|---|
| Boiling Point | 290 ºC |
| Melting Point | 138-140 ºC |
| Molecular Formula | C9H15BO2Si |
| Molecular Weight | 194.111 |
| Flash Point | 129 ºC |
| Exact Mass | 194.093430 |
| PSA | 40.46000 |
| LogP | 4.09 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | REMKRZLFPLDTKR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1cccc(B(O)O)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~85%
3-(Trimethylsil... CAS#:177171-16-3 |
| Literature: Burn, Paul Leslie; Samuel, Ifor David William; Cumpstey, Neil Patent: US2008/211391 A1, 2008 ; |
|
~%
3-(Trimethylsil... CAS#:177171-16-3 |
| Literature: Molecular Crystals and Liquid Crystals, , vol. 444, p. 95 - 101 |
|
~%
3-(Trimethylsil... CAS#:177171-16-3 |
| Literature: Molecular Crystals and Liquid Crystals, , vol. 444, p. 95 - 101 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [3-(Trimethylsilyl)phenyl]boronic acid |
| 3-(TriMethylsilyl)phenylboronic Acid |
| MFCD03093884 |
| Boronic acid, B-[3-(trimethylsilyl)phenyl]- |
| (3-trimethylsilylphenyl)boronic acid |
| 3-(Trimethylsilyl)benzeneboronic Acid |
| (3-(Trimethylsilyl)phenyl)boronic acid |