N,N'-bis(3-chlorophenyl)propanediamide structure
|
Common Name | N,N'-bis(3-chlorophenyl)propanediamide | ||
|---|---|---|---|---|
| CAS Number | 17722-14-4 | Molecular Weight | 323.17400 | |
| Density | 1.443g/cm3 | Boiling Point | 591.6ºC at 760 mmHg | |
| Molecular Formula | C15H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.6ºC | |
| Name | N,N'-bis(3-chlorophenyl)propanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 591.6ºC at 760 mmHg |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.17400 |
| Flash Point | 311.6ºC |
| Exact Mass | 322.02800 |
| PSA | 58.20000 |
| LogP | 4.10670 |
| Vapour Pressure | 5.74E-14mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | XZWOXAMUBVDXBL-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)Nc1cccc(Cl)c1)Nc1cccc(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-Bis-(3-chlor-phenyl)-malonamid |
| N.N'-Bis-(3-chlor-phenyl)-malonsaeurediamid |
| N,N'-bis(3-chloro-phenyl)-propanediamide |
| m,m'-Dichloromaloanilide |
| Malonsaeure-bis-(3-chlor-anilid) |
| N,N'-Bis-(3-chloro-phenyl)-malonamide |