N-(4-Chlorophenyl)-succinamide
Modify Date: 2025-08-24 20:11:59
N-(4-Chlorophenyl)-succinamide structure
|
Common Name | N-(4-Chlorophenyl)-succinamide | ||
|---|---|---|---|---|
| CAS Number | 17722-52-0 | Molecular Weight | 227.64400 | |
| Density | 1.346 g/cm3 | Boiling Point | 530.6ºC at 760 mmHg | |
| Molecular Formula | C10H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.7ºC | |
| Name | 4-[(4-chlorophenyl)amino]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.346 g/cm3 |
|---|---|
| Boiling Point | 530.6ºC at 760 mmHg |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.64400 |
| Flash Point | 274.7ºC |
| Exact Mass | 227.03500 |
| PSA | 66.40000 |
| LogP | 2.21630 |
| Vapour Pressure | 3.06E-10mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | UPSNSRKMOHOEEO-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)Nc1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(p-Chlorphenyl)succinamsaeure |
| 3-(4-Chlor-phenylcarbamoyl)-propionsaeure |
| N-(4-chloro-phenyl)-succinamic acid |
| N-(4-Chlor-phenyl)-succinamidsaeure |