bis(2,4,6-trichlorophenyl) phosphorochloridate structure
|
Common Name | bis(2,4,6-trichlorophenyl) phosphorochloridate | ||
|---|---|---|---|---|
| CAS Number | 17725-11-0 | Molecular Weight | 475.30300 | |
| Density | 1.743g/cm3 | Boiling Point | 523.6ºC at 760 mmHg | |
| Molecular Formula | C12H4Cl7O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 463.2ºC | |
| Name | 1,3,5-trichloro-2-[chloro-(2,4,6-trichlorophenoxy)phosphoryl]oxybenzene |
|---|
| Density | 1.743g/cm3 |
|---|---|
| Boiling Point | 523.6ºC at 760 mmHg |
| Molecular Formula | C12H4Cl7O3P |
| Molecular Weight | 475.30300 |
| Flash Point | 463.2ºC |
| Exact Mass | 471.77200 |
| PSA | 45.34000 |
| LogP | 8.41170 |
| Vapour Pressure | 1.56E-10mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | DXKZQNUSKZOLTC-UHFFFAOYSA-N |
| SMILES | O=P(Cl)(Oc1c(Cl)cc(Cl)cc1Cl)Oc1c(Cl)cc(Cl)cc1Cl |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |