Diclonixin structure
|
Common Name | Diclonixin | ||
|---|---|---|---|---|
| CAS Number | 17737-68-7 | Molecular Weight | 283.11000 | |
| Density | 1.529g/cm3 | Boiling Point | 412ºC at 760mmHg | |
| Molecular Formula | C12H8Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203ºC | |
| Name | 2-(2,3-dichloroanilino)pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.529g/cm3 |
|---|---|
| Boiling Point | 412ºC at 760mmHg |
| Molecular Formula | C12H8Cl2N2O2 |
| Molecular Weight | 283.11000 |
| Flash Point | 203ºC |
| Exact Mass | 281.99600 |
| PSA | 62.22000 |
| LogP | 3.90320 |
| Vapour Pressure | 1.58E-07mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | IFMIBXMJNXNGHQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccnc1Nc1cccc(Cl)c1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Diclonixinum |
| Diclonixine |
| Diclonixino |