Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate
Modify Date: 2025-09-10 13:25:05
![Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate Structure](https://www.chemsrc.com/extcaspic/008/1773851-90-3.png)
Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate structure
|
Common Name | Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate | ||
|---|---|---|---|---|
| CAS Number | 1773851-90-3 | Molecular Weight | 253.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO2S |
|---|---|
| Molecular Weight | 253.36 |
| InChIKey | DSVHBFKXXAIJQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CSCc1cccc(N)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate? |
| A: SMILES notation of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate is CC(C)(C)OC(=O)CSCc1cccc(N)c1. |
| Q: What is the Chinese name of 1773851-90-3? |
| A: Chinese name of 1773851-90-3 is 1773851-90-3. |
| Q: What is the CAS number of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate? |
| A: CAS number of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate is 1773851-90-3. |
| Q: What is the English name of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate? |
| A: The English name of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate is Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate. |
| Q: What is the molecular formula of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate? |
| A: Molecular formula of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate is C13H19NO2S. |
| Q: What is the molecular weight of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate? |
| A: Molecular weight of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate is 253.36. |
| Q: What is the InChIKey of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate? |
| A: InChIKey of Tert-butyl 2-{[(3-aminophenyl)methyl]sulfanyl}acetate is DSVHBFKXXAIJQR-UHFFFAOYSA-N. |