Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate
Modify Date: 2025-08-30 16:32:34
Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate structure
|
Common Name | Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1773890-27-9 | Molecular Weight | 276.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16N2O2S |
|---|---|
| Molecular Weight | 276.36 |
| InChIKey | LDEMXQACGWPNCM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1snc(-c2ccccc2)c1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate? |
| A: SMILES notation of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate is CC(C)(C)OC(=O)c1snc(-c2ccccc2)c1N. |
| Q: What is the molecular weight of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate? |
| A: Molecular weight of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate is 276.36. |
| Q: What is the molecular formula of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate? |
| A: Molecular formula of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate is C14H16N2O2S. |
| Q: What is the InChIKey of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate? |
| A: InChIKey of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate is LDEMXQACGWPNCM-UHFFFAOYSA-N. |
| Q: What is the English name of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate? |
| A: The English name of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate is Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate. |
| Q: What is the Chinese name of 1773890-27-9? |
| A: Chinese name of 1773890-27-9 is 1773890-27-9. |
| Q: What is the CAS number of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate? |
| A: CAS number of Tert-butyl 4-amino-3-phenyl-1,2-thiazole-5-carboxylate is 1773890-27-9. |