tert-butyl 4-(2-methoxy-5-nitrophenyl)piperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-(2-methoxy-5-nitrophenyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 177488-99-2 | Molecular Weight | 337.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 4-(2-methoxy-5-nitrophenyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H23N3O5 |
|---|---|
| Molecular Weight | 337.37100 |
| Exact Mass | 337.16400 |
| PSA | 87.83000 |
| LogP | 3.18660 |
| InChIKey | DHRZDWFUDYCPGZ-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])cc1N1CCN(C(C)(C)C)CC1 |
| HS Code | 2933599090 |
|---|
|
~86%
tert-butyl 4-(2... CAS#:177488-99-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 42, # 2 p. 202 - 205 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(2-Methoxy-5-nitro-phenyl)-piperazine-1-carboxylic acid tert-butyl ester |
| 1-(tert-Butyl)-4-(2-methoxy-5-nitrophenyl)piperazine |