N-(2,6-dichlorophenyl)-2-(diethylamino)acetamide structure
|
Common Name | N-(2,6-dichlorophenyl)-2-(diethylamino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 17751-06-3 | Molecular Weight | 275.17400 | |
| Density | 1.252g/cm3 | Boiling Point | 393.8ºC at 760 mmHg | |
| Molecular Formula | C12H16Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9ºC | |
| Name | N-(2,6-dichlorophenyl)-2-(diethylamino)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 393.8ºC at 760 mmHg |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.17400 |
| Flash Point | 191.9ºC |
| Exact Mass | 274.06400 |
| PSA | 35.83000 |
| LogP | 3.92320 |
| Vapour Pressure | 2.08E-06mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | CIQALKSZMQAMMD-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)Nc1c(Cl)cccc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ACETANILIDE,2',6'-DICHLORO-2-DIETHYLAMINO |
| 2',6'-Dichloro-2-diethylaminoacetanilide |