ethyl 2-[(2,4-dinitrophenyl)hydrazinylidene]propanoate structure
|
Common Name | ethyl 2-[(2,4-dinitrophenyl)hydrazinylidene]propanoate | ||
|---|---|---|---|---|
| CAS Number | 17767-38-3 | Molecular Weight | 296.23600 | |
| Density | 1.45g/cm3 | Boiling Point | 423.5ºC at 760 mmHg | |
| Molecular Formula | C11H12N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.9ºC | |
| Name | ethyl 2-[(2,4-dinitrophenyl)hydrazinylidene]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 423.5ºC at 760 mmHg |
| Molecular Formula | C11H12N4O6 |
| Molecular Weight | 296.23600 |
| Flash Point | 209.9ºC |
| Exact Mass | 296.07600 |
| PSA | 142.33000 |
| LogP | 2.97330 |
| Vapour Pressure | 2.22E-07mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | LVJPOPBBYFTTPI-KPKJPENVSA-N |
| SMILES | CCOC(=O)C(C)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| ethyl pyrrolo<1,2-a>quinoline-2-carboxylate |
| 2,4-dinitrophenylhydrazone of ethyl pyruvate |
| ethyl pyruvate 2,4-dinitrophenyl hydrazone |
| Aethylpyruvate-(2,4-dinitrophenyl)-hydrazon |
| ethyl pyruvate 2,4-dinitriphenyl hydrazone |