Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate
Modify Date: 2026-08-07 18:35:16
Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate structure
|
Common Name | Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate | ||
|---|---|---|---|---|
| CAS Number | 1777707-27-3 | Molecular Weight | 308.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11F3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11F3O4S |
|---|---|
| Molecular Weight | 308.28 |
| InChIKey | FFVDUVKCQWZNSG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)OC)=S(c1ccccc1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate? |
| A: Molecular weight of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate is 308.28. |
| Q: What is the English name of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate? |
| A: The English name of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate is Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate. |
| Q: What is the Chinese name of 1777707-27-3? |
| A: Chinese name of 1777707-27-3 is 1777707-27-3. |
| Q: What is the CAS number of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate? |
| A: CAS number of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate is 1777707-27-3. |
| Q: What is the molecular formula of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate? |
| A: Molecular formula of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate is C12H11F3O4S. |
| Q: What is the InChIKey of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate? |
| A: InChIKey of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate is FFVDUVKCQWZNSG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate? |
| A: SMILES notation of Dimethyl 2-(phenyl(trifluoromethyl)-l4-sulfanylidene)malonate is COC(=O)C(C(=O)OC)=S(c1ccccc1)C(F)(F)F. |