ethyl 3,3-diphenylprop-2-enoate
ethyl 3,3-diphenylprop-2-enoate structure
|
Common Name | ethyl 3,3-diphenylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 17792-17-5 | Molecular Weight | 252.30800 | |
| Density | 1.081g/cm3 | Boiling Point | 371.022ºC at 760 mmHg | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.01ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 3,3-diphenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 371.022ºC at 760 mmHg |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.30800 |
| Flash Point | 216.01ºC |
| Exact Mass | 252.11500 |
| PSA | 26.30000 |
| LogP | 3.68140 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | SIVYACOIQCOIKW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 3,3-diphenyl-2-propenoate |
| 3,3-diphenyl-acrylic acid ethyl ester |
| ethyl 3,3-diphenylpropenoate |
| ethyl 3-phenylcinnamate |
| 2-Propenoic acid,3,3-diphenyl-,ethyl ester |
| ethyl 3,3-diphenylacrylate |
| 3,3-diphenylpropenoic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 17792-17-5? |
| A: Chinese name of 17792-17-5 is 17792-17-5. |
| Q: What is the English name of ethyl 3,3-diphenylprop-2-enoate? |
| A: The English name of ethyl 3,3-diphenylprop-2-enoate is ethyl 3,3-diphenylprop-2-enoate. |
| Q: What is the CAS number of ethyl 3,3-diphenylprop-2-enoate? |
| A: CAS number of ethyl 3,3-diphenylprop-2-enoate is 17792-17-5. |
| Q: What is the LogP of ethyl 3,3-diphenylprop-2-enoate? |
| A: LogP of ethyl 3,3-diphenylprop-2-enoate is 3.68140. |
| Q: What is the boiling point of ethyl 3,3-diphenylprop-2-enoate? |
| A: Boiling point of ethyl 3,3-diphenylprop-2-enoate is 371.022ºC at 760 mmHg. |
| Q: What is the SMILES notation of ethyl 3,3-diphenylprop-2-enoate? |
| A: SMILES notation of ethyl 3,3-diphenylprop-2-enoate is CCOC(=O)C=C(c1ccccc1)c1ccccc1. |
| Q: What is the InChIKey of ethyl 3,3-diphenylprop-2-enoate? |
| A: InChIKey of ethyl 3,3-diphenylprop-2-enoate is SIVYACOIQCOIKW-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 3,3-diphenylprop-2-enoate? |
| A: Molecular weight of ethyl 3,3-diphenylprop-2-enoate is 252.30800. |
| Q: What is the molecular formula of ethyl 3,3-diphenylprop-2-enoate? |
| A: Molecular formula of ethyl 3,3-diphenylprop-2-enoate is C17H16O2. |
| Q: What is the polar surface area (PSA) of ethyl 3,3-diphenylprop-2-enoate? |
| A: Polar surface area (PSA) of ethyl 3,3-diphenylprop-2-enoate is 26.30000. |