(1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol
Modify Date: 2025-08-28 10:52:05
(1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol structure
|
Common Name | (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 1779335-53-3 | Molecular Weight | 241.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17F2NO |
|---|---|
| Molecular Weight | 241.28 |
| InChIKey | FRRXSFVYIXDVOH-UHFFFAOYSA-N |
| SMILES | OCC1CCN(Cc2c(F)cccc2F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol? |
| A: InChIKey of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol is FRRXSFVYIXDVOH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1779335-53-3? |
| A: Chinese name of 1779335-53-3 is 1779335-53-3. |
| Q: What is the English name of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol? |
| A: The English name of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol is (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol. |
| Q: What is the molecular formula of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol? |
| A: Molecular formula of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol is C13H17F2NO. |
| Q: What is the SMILES notation of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol? |
| A: SMILES notation of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol is OCC1CCN(Cc2c(F)cccc2F)CC1. |
| Q: What is the CAS number of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol? |
| A: CAS number of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol is 1779335-53-3. |
| Q: What is the molecular weight of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol? |
| A: Molecular weight of (1-(2,6-Difluorobenzyl)piperidin-4-yl)methanol is 241.28. |