2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole
![2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole Structure](https://image.chemsrc.com/caspic/439/177937-86-9.png)
2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole structure
|
Common Name | 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole | ||
|---|---|---|---|---|
| CAS Number | 177937-86-9 | Molecular Weight | 250.08200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9Cl2N3O2 |
|---|---|
| Molecular Weight | 250.08200 |
| Exact Mass | 249.00700 |
| PSA | 63.64000 |
| LogP | 2.71250 |
| InChIKey | IYEJQGLODJDTHN-UHFFFAOYSA-N |
| SMILES | Cn1c([N+](=O)[O-])cnc1C=C(CCl)CCl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-[3-chloro-2-(... CAS#:177937-86-9 |
| Literature: Vanelle, Patrice; Benakli, Kamel; Maldonado, Jose; Roubaud, Christine; Crozet, Michel P. Heterocycles, 1996 , vol. 43, # 4 p. 731 - 735 |
|
~%
2-[3-chloro-2-(... CAS#:177937-86-9 |
| Literature: Vanelle, Patrice; Benakli, Kamel; Maldonado, Jose; Roubaud, Christine; Crozet, Michel P. Heterocycles, 1996 , vol. 43, # 4 p. 731 - 735 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole? |
| A: LogP of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole is 2.71250. |
| Q: What is the SMILES notation of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole? |
| A: SMILES notation of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole is Cn1c([N+](=O)[O-])cnc1C=C(CCl)CCl. |
| Q: What is the Chinese name of 177937-86-9? |
| A: Chinese name of 177937-86-9 is 177937-86-9. |
| Q: What is the molecular weight of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole? |
| A: Molecular weight of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole is 250.08200. |
| Q: What is the InChIKey of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole? |
| A: InChIKey of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole is IYEJQGLODJDTHN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole? |
| A: Molecular formula of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole is C8H9Cl2N3O2. |
| Q: What is the CAS number of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole? |
| A: CAS number of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole is 177937-86-9. |
| Q: What is the English name of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole? |
| A: The English name of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole is 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole. |
| Q: What is the polar surface area (PSA) of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole? |
| A: Polar surface area (PSA) of 2-[3-chloro-2-(chloromethyl)prop-1-enyl]-1-methyl-5-nitroimidazole is 63.64000. |