N-Methylcarbamic acid 3-[(2-methylhexanoyl)amino]phenyl ester structure
|
Common Name | N-Methylcarbamic acid 3-[(2-methylhexanoyl)amino]phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 17795-81-2 | Molecular Weight | 278.34700 | |
| Density | 1.107g/cm3 | Boiling Point | 427.4ºC at 760 mmHg | |
| Molecular Formula | C15H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.3ºC | |
| Name | [3-(hexanoylamino)-2-methylphenyl] N-methylcarbamate |
|---|
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 427.4ºC at 760 mmHg |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.34700 |
| Flash Point | 212.3ºC |
| Exact Mass | 278.16300 |
| PSA | 74.41000 |
| LogP | 4.08590 |
| Vapour Pressure | 1.64E-07mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | ORPVNCWUQBNHCF-UHFFFAOYSA-N |
| SMILES | CCCCC(C)C(=O)Nc1cccc(OC(=O)NC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |