4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane
4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane structure
|
Common Name | 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane | ||
|---|---|---|---|---|
| CAS Number | 177950-03-7 | Molecular Weight | 262.15200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23BO3 |
|---|---|
| Molecular Weight | 262.15200 |
| Exact Mass | 262.17400 |
| PSA | 27.69000 |
| LogP | 3.54770 |
| InChIKey | XCHSHIAFJZVUSL-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(CCCOc2ccccc2)OC1(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~79%
4,4,5,5-tetrame... CAS#:177950-03-7 |
| Literature: Gong, Tian-Jun; Jiang, Yuan-Ye; Fu, Yao Chinese Chemical Letters, 2014 , vol. 25, # 3 p. 397 - 400 |
|
~87%
4,4,5,5-tetrame... CAS#:177950-03-7 |
| Literature: Yamamoto, Yasunori; Fujikawa, Rhyou; Umemoto, Tomokazu; Miyaura, Norio Tetrahedron, 2004 , vol. 60, # 47 p. 10695 - 10700 |
|
~86%
4,4,5,5-tetrame... CAS#:177950-03-7 |
| Literature: Yi, Jun; Liu, Jin-Hui; Liang, Jun; Dai, Jian-Jun; Yang, Chu-Ting; Fu, Yao; Liu, Lei Advanced Synthesis and Catalysis, 2012 , vol. 354, # 9 p. 1685 - 1691 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane? |
| A: Molecular weight of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane is 262.15200. |
| Q: What is the LogP of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane? |
| A: LogP of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane is 3.54770. |
| Q: What is the CAS number of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane? |
| A: CAS number of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane is 177950-03-7. |
| Q: What is the polar surface area (PSA) of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane? |
| A: Polar surface area (PSA) of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane is 27.69000. |
| Q: What is the molecular formula of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane? |
| A: Molecular formula of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane is C15H23BO3. |
| Q: What is the English name of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane? |
| A: The English name of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane is 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane. |
| Q: What is the SMILES notation of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane? |
| A: SMILES notation of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane is CC1(C)OB(CCCOc2ccccc2)OC1(C)C. |
| Q: What is the InChIKey of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane? |
| A: InChIKey of 4,4,5,5-tetramethyl-2-(3-phenoxypropyl)-1,3,2-dioxaborolane is XCHSHIAFJZVUSL-UHFFFAOYSA-N. |