3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene structure
|
Common Name | 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene | ||
|---|---|---|---|---|
| CAS Number | 1779939-89-7 | Molecular Weight | 180.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16N2O |
|---|---|
| Molecular Weight | 180.25 |
| InChIKey | QOSOXEPLUUWYKZ-UHFFFAOYSA-N |
| SMILES | C1CC2(CCN1)CC(C1CC1)=NO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene? |
| A: SMILES notation of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene is C1CC2(CCN1)CC(C1CC1)=NO2. |
| Q: What is the molecular weight of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene? |
| A: Molecular weight of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene is 180.25. |
| Q: What is the molecular formula of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene? |
| A: Molecular formula of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene is C10H16N2O. |
| Q: What is the English name of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene? |
| A: The English name of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene is 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene. |
| Q: What is the InChIKey of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene? |
| A: InChIKey of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene is QOSOXEPLUUWYKZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene? |
| A: CAS number of 3-Cyclopropyl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene is 1779939-89-7. |
| Q: What is the Chinese name of 1779939-89-7? |
| A: Chinese name of 1779939-89-7 is 1779939-89-7. |