8-BROMO-7-ETHYL-1,3-DIMETHYL-2,3,6,7-TETRAHYDRO-1H-PURINE-2,6-DIONE structure
|
Common Name | 8-BROMO-7-ETHYL-1,3-DIMETHYL-2,3,6,7-TETRAHYDRO-1H-PURINE-2,6-DIONE | ||
|---|---|---|---|---|
| CAS Number | 17801-69-3 | Molecular Weight | 287.11300 | |
| Density | 1.77g/cm3 | Boiling Point | 443.2ºC at 760mmHg | |
| Molecular Formula | C9H11BrN4O2 | Melting Point | 170-173ºC | |
| MSDS | N/A | Flash Point | 221.8ºC | |
| Name | 8-bromo-7-ethyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.77g/cm3 |
|---|---|
| Boiling Point | 443.2ºC at 760mmHg |
| Melting Point | 170-173ºC |
| Molecular Formula | C9H11BrN4O2 |
| Molecular Weight | 287.11300 |
| Flash Point | 221.8ºC |
| Exact Mass | 286.00700 |
| PSA | 61.82000 |
| LogP | 0.21610 |
| Vapour Pressure | 4.73E-08mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | WQTJWJGESBNSKG-UHFFFAOYSA-N |
| SMILES | CCn1c(Br)nc2c1c(=O)n(C)c(=O)n2C |
| HS Code | 2933990090 |
|---|
|
~%
8-BROMO-7-ETHYL... CAS#:17801-69-3 |
| Literature: Biltz; Beck Journal fuer Praktische Chemie (Leipzig), 1928 , vol. <2>118, p. 161 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Ethyl-8-bromtheophyllin |
| 7-Aethyl-8-brom-1,3-dimethyl-3,7-dihydro-purin-2,6-dion |
| 8-bromo-7-ethyl-1,3-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione |
| F0373-0284 |
| 7-ethyl-8-bromo-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |