1-methoxy-4-(2-nitro-1(Z)-ethenyl)benzene
Modify Date: 2026-07-15 11:38:38
1-methoxy-4-(2-nitro-1(Z)-ethenyl)benzene structure
|
Common Name | 1-methoxy-4-(2-nitro-1(Z)-ethenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 178101-25-2 | Molecular Weight | 179.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methoxy-4-(2-nitro-1(Z)-ethenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9NO3 |
|---|---|
| Molecular Weight | 179.17300 |
| Exact Mass | 179.05800 |
| PSA | 55.05000 |
| LogP | 2.46580 |
| InChIKey | JKQUXSHVQGBODD-SREVYHEPSA-N |
| SMILES | COc1ccc(C=C[N+](=O)[O-])cc1 |
|
Name: Antioxidant activity assessed as trolox equivalent of AAPH-induced peroxyl radical sc...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4264721
|
Total 1, Current Page 1 of 1
1
| 4-methoxy-ω-nitrostyrene |
| β-Nitro-p-methoxystyrol |
| (Z)-1-methoxy-4-(2-nitrovinyl)benzene |