1,2-Benzenedimethanol,3-methoxy-4-methyl-5-[(3-methyl-2-buten-1-yl)oxy]- structure
|
Common Name | 1,2-Benzenedimethanol,3-methoxy-4-methyl-5-[(3-methyl-2-buten-1-yl)oxy]- | ||
|---|---|---|---|---|
| CAS Number | 17811-28-8 | Molecular Weight | 266.33300 | |
| Density | 1.106g/cm3 | Boiling Point | 425.3ºC at 760mmHg | |
| Molecular Formula | C15H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211ºC | |
| Name | [2-(hydroxymethyl)-3-methoxy-4-methyl-5-(3-methylbut-2-enoxy)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 425.3ºC at 760mmHg |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33300 |
| Flash Point | 211ºC |
| Exact Mass | 266.15200 |
| PSA | 58.92000 |
| LogP | 2.33320 |
| Vapour Pressure | 5.45E-08mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | DUMQPTRUYCCSEZ-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(OCC=C(C)C)cc(CO)c1CO |
| HS Code | 2909499000 |
|---|
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Zinniol |
| 1,2-Bis-hydroxymethyl-5-<3,3-dimethyl-allyloxy>-3-methoxy-4-methyl-benzol,Zinniol |