γ-CEHC
γ-CEHC structure
|
Common Name | γ-CEHC | ||
|---|---|---|---|---|
| CAS Number | 178167-75-4 | Molecular Weight | 264.32 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 466.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5±22.2 °C | |
Use of γ-CEHCγ-CEHC is a γ-tocopherol (HY-N7148) metabolite. γ-CEHC is mainly excreted into the urine rather than into the bile. γ-CEHC is present in conjugated form in human urine, mainly as glucuronide[1]. |
Summary: γ-CEHC (3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid) is a chemical compound with CAS number 178167-75-4, molecular formula C15H20O4, and molecular weight 264.32. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | γ-CEHC is a γ-tocopherol (HY-N7148) metabolite. γ-CEHC is mainly excreted into the urine rather than into the bile. γ-CEHC is present in conjugated form in human urine, mainly as glucuronide[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 466.9±45.0 °C at 760 mmHg |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| Flash Point | 174.5±22.2 °C |
| Exact Mass | 264.136169 |
| PSA | 66.76000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | VMJQLPNCUPGMNQ-UHFFFAOYSA-N |
| SMILES | Cc1c(O)cc2c(c1C)OC(C)(CCC(=O)O)CC2 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(6-Hydroxy-2,7,8-trimethyl-3,4-dihydro-2H-chromen-2-yl)propanoic acid |
| 2,7,8-trimethyl-2-(β-carboxyethyl)-6-hydroxychroman |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid? |
| A: The English name of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid is 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid. |
| Q: What is the CAS number of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid? |
| A: CAS number of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid is 178167-75-4. |
| Q: What is the LogP of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid? |
| A: LogP of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid is 3.17. |
| Q: What is the SMILES notation of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid? |
| A: SMILES notation of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid is Cc1c(O)cc2c(c1C)OC(C)(CCC(=O)O)CC2. |
| Q: What is the InChIKey of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid? |
| A: InChIKey of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid is VMJQLPNCUPGMNQ-UHFFFAOYSA-N. |
| Q: What is the boiling point of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid? |
| A: Boiling point of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid is 466.9±45.0 °C at 760 mmHg. |
| Q: What is the molecular formula of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid? |
| A: Molecular formula of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid is C15H20O4. |
| Q: What is the polar surface area (PSA) of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid? |
| A: Polar surface area (PSA) of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid is 66.76000. |
| Q: What English synonyms does 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid have? |
| A: English synonyms of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid: 3-(6-Hydroxy-2,7,8-trimethyl-3,4-dihydro-2H-chromen-2-yl)propanoic acid, 2,7,8-trimethyl-2-(β-carboxyethyl)-6-hydroxychroman. |
| Q: What is the molecular weight of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid? |
| A: Molecular weight of 3-(6-hydroxy-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)propanoic acid is 264.32. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |