Zaleplon-d4
Modify Date: 2025-09-09 19:54:58
Zaleplon-d4 structure
|
Common Name | Zaleplon-d4 | ||
|---|---|---|---|---|
| CAS Number | 1781887-91-9 | Molecular Weight | 309.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Zaleplon-d4 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H15N5O |
|---|---|
| Molecular Weight | 309.36 |
| InChIKey | HUNXMJYCHXQEGX-FMJFQTNXSA-N |
| SMILES | CCN(C(C)=O)c1cccc(-c2ccnc3c(C#N)cnn23)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Zaleplon-d4? |
| A: Molecular weight of Zaleplon-d4 is 309.36. |
| Q: What is the Chinese name of 1781887-91-9? |
| A: Chinese name of 1781887-91-9 is 1781887-91-9. |
| Q: What is the molecular formula of Zaleplon-d4? |
| A: Molecular formula of Zaleplon-d4 is C17H15N5O. |
| Q: What is the English name of Zaleplon-d4? |
| A: The English name of Zaleplon-d4 is Zaleplon-d4. |
| Q: What is the CAS number of Zaleplon-d4? |
| A: CAS number of Zaleplon-d4 is 1781887-91-9. |
| Q: What is the InChIKey of Zaleplon-d4? |
| A: InChIKey of Zaleplon-d4 is HUNXMJYCHXQEGX-FMJFQTNXSA-N. |
| Q: What is the SMILES notation of Zaleplon-d4? |
| A: SMILES notation of Zaleplon-d4 is CCN(C(C)=O)c1cccc(-c2ccnc3c(C#N)cnn23)c1. |