Desalkylgidazepam-d5
Modify Date: 2026-07-17 21:27:23
Desalkylgidazepam-d5 structure
|
Common Name | Desalkylgidazepam-d5 | ||
|---|---|---|---|---|
| CAS Number | 1782531-89-8 | Molecular Weight | 320.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Desalkylgidazepam-d5 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11BrN2O |
|---|---|
| Molecular Weight | 320.19 |
| InChIKey | ATCCWKYKHCKDGT-RALIUCGRSA-N |
| SMILES | O=C1CN=C(c2ccccc2)c2cc(Br)ccc2N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Desalkylgidazepam-d5? |
| A: Molecular weight of Desalkylgidazepam-d5 is 320.19. |
| Q: What is the English name of Desalkylgidazepam-d5? |
| A: The English name of Desalkylgidazepam-d5 is Desalkylgidazepam-d5. |
| Q: What is the InChIKey of Desalkylgidazepam-d5? |
| A: InChIKey of Desalkylgidazepam-d5 is ATCCWKYKHCKDGT-RALIUCGRSA-N. |
| Q: What is the Chinese name of 1782531-89-8? |
| A: Chinese name of 1782531-89-8 is 1782531-89-8. |
| Q: What is the CAS number of Desalkylgidazepam-d5? |
| A: CAS number of Desalkylgidazepam-d5 is 1782531-89-8. |
| Q: What is the SMILES notation of Desalkylgidazepam-d5? |
| A: SMILES notation of Desalkylgidazepam-d5 is O=C1CN=C(c2ccccc2)c2cc(Br)ccc2N1. |
| Q: What is the molecular formula of Desalkylgidazepam-d5? |
| A: Molecular formula of Desalkylgidazepam-d5 is C15H11BrN2O. |