5,6-Dibromoindoline-2,3-dione structure
|
Common Name | 5,6-Dibromoindoline-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 17826-05-0 | Molecular Weight | 304.923 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H3Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6-dibromo-1H-indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C8H3Br2NO2 |
| Molecular Weight | 304.923 |
| Exact Mass | 302.853027 |
| PSA | 49.66000 |
| LogP | 2.40 |
| Index of Refraction | 1.679 |
| InChIKey | BHIYOAMJNNOSLP-UHFFFAOYSA-N |
| SMILES | O=C1Nc2cc(Br)c(Br)cc2C1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-Dibromoindoline-2,3-dione |
| 5,6-Dibromo-1H-indole-2,3-dione |
| 5,6-dibromo-indole-2,3-dione |
| 5,6-Dibrom-indolin-2,3-dion |
| 5,6-dibromo-isatin |
| 1H-Indole-2,3-dione, 5,6-dibromo- |
| 5,6-Dibrom-isatin |