4'-(4-AMINOPHENYL)-2,2':6',2''-TERPYRIDINE structure
|
Common Name | 4'-(4-AMINOPHENYL)-2,2':6',2''-TERPYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 178265-65-1 | Molecular Weight | 324.37900 | |
| Density | 1.213g/cm3 | Boiling Point | 513ºC at 760mmHg | |
| Molecular Formula | C21H16N4 | Melting Point | 253-254 ℃ | |
| MSDS | N/A | Flash Point | 296.8ºC | |
| Name | 4-(2,6-dipyridin-2-ylpyridin-4-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 513ºC at 760mmHg |
| Melting Point | 253-254 ℃ |
| Molecular Formula | C21H16N4 |
| Molecular Weight | 324.37900 |
| Flash Point | 296.8ºC |
| Exact Mass | 324.13700 |
| PSA | 64.69000 |
| LogP | 5.03600 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | CYISWQZYBSHTNN-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-([2,2':6',2''-Terpyridin]-4'-yl)aniline |
| 4'-(p-aminophenyl)-2,2':6',2''-terpyridine |
| 4'-(4-aminophenyl)-2,2':6',2"-terpyridine |