2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol
Modify Date: 2025-09-24 18:13:14
2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol structure
|
Common Name | 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 1783775-56-3 | Molecular Weight | 276.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14BrNO3 |
|---|---|
| Molecular Weight | 276.13 |
| InChIKey | GWBVOFOQZGSVAX-UHFFFAOYSA-N |
| SMILES | COc1cc(C(O)CN)cc(OC)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol? |
| A: The English name of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol is 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol. |
| Q: What is the SMILES notation of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol? |
| A: SMILES notation of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol is COc1cc(C(O)CN)cc(OC)c1Br. |
| Q: What is the Chinese name of 1783775-56-3? |
| A: Chinese name of 1783775-56-3 is 1783775-56-3. |
| Q: What is the molecular weight of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol? |
| A: Molecular weight of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol is 276.13. |
| Q: What is the molecular formula of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol? |
| A: Molecular formula of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol is C10H14BrNO3. |
| Q: What is the InChIKey of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol? |
| A: InChIKey of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol is GWBVOFOQZGSVAX-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol? |
| A: CAS number of 2-Amino-1-(4-bromo-3,5-dimethoxyphenyl)ethan-1-ol is 1783775-56-3. |