7-chloro-5-cyclohexyl-1,3-dihydro-1-methyl-2H-1,4-benzodiazepin-2-one structure
|
Common Name | 7-chloro-5-cyclohexyl-1,3-dihydro-1-methyl-2H-1,4-benzodiazepin-2-one | ||
|---|---|---|---|---|
| CAS Number | 1784-78-7 | Molecular Weight | 290.78800 | |
| Density | 1.28g/cm3 | Boiling Point | 493.9ºC at 760mmHg | |
| Molecular Formula | C16H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.5ºC | |
| Name | 7-chloro-5-cyclohexyl-1-methyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 493.9ºC at 760mmHg |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.78800 |
| Flash Point | 252.5ºC |
| Exact Mass | 290.11900 |
| PSA | 32.67000 |
| LogP | 3.18640 |
| Vapour Pressure | 6.75E-10mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | WOWMEMNXULCAKT-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CN=C(C2CCCCC2)c2cc(Cl)ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-chloro-5-cyclohexyl-1-methyl-1,3-dihydro-2h-1,4-benzodiazepin-2-one |
| EINECS 217-237-2 |
| 7-Chloro-5-cyclohexyl-1,3-dihydro-1-methyl-2H-1,4-benzodiazepin-2-one |
| 7-chloro-5-cyclohexyl-1,3-dihydro-1-methyl-2H-1,4-benzodiazepin-2-one |
| Ro 05-3328 |