6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid
Modify Date: 2026-09-28 19:06:44
![6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/005/1784597-50-7.png)
6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid structure
|
Common Name | 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1784597-50-7 | Molecular Weight | 238.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11ClO3 |
|---|---|
| Molecular Weight | 238.66 |
| InChIKey | MLFMKEHMBCKEPZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CC12CCOc1ccc(Cl)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1784597-50-7? |
| A: Chinese name of 1784597-50-7 is 1784597-50-7. |
| Q: What is the InChIKey of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid? |
| A: InChIKey of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid is MLFMKEHMBCKEPZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid? |
| A: Molecular weight of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid is 238.66. |
| Q: What is the CAS number of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid? |
| A: CAS number of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid is 1784597-50-7. |
| Q: What is the SMILES notation of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid? |
| A: SMILES notation of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid is O=C(O)C1CC12CCOc1ccc(Cl)cc12. |
| Q: What is the molecular formula of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid? |
| A: Molecular formula of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid is C12H11ClO3. |
| Q: What is the English name of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid? |
| A: The English name of 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid is 6-Chlorospiro[chromane-4,2'-cyclopropane]-1'-carboxylic acid. |