IMidazo[1,2-a]pyridine, 8-chloro-6-(trifluoromethyl)- structure
|
Common Name | IMidazo[1,2-a]pyridine, 8-chloro-6-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 178488-36-3 | Molecular Weight | 220.57900 | |
| Density | 1.53±0.1 g/cm3(Predicted) | Boiling Point | N/A | |
| Molecular Formula | C8H4ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53±0.1 g/cm3(Predicted) |
|---|---|
| Molecular Formula | C8H4ClF3N2 |
| Molecular Weight | 220.57900 |
| Exact Mass | 220.00200 |
| PSA | 17.30000 |
| LogP | 3.00650 |
| InChIKey | BWSHPRLSCABXRL-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Cl)c2nccn2c1 |
| HS Code | 2933990090 |
|---|
|
~76%
IMidazo[1,2-a]p... CAS#:178488-36-3 |
| Literature: Gueiffier, Alain; Lhassani, Mohammed; Elhakmaoui, Ahmed; Snoeck, Robert; Andrei, Graciela; Chavignon, Olivier; Teulade, Jean-Claude; Kerbal, Abdelali; Essassi, El Mokhtar; Debouzy, Jean-Claude; Witvrouw, Myriam; Blache, Yves; Balzarini, Jan; De Clercq, Erik; Chapat, Jean-Pierre Journal of Medicinal Chemistry, 1996 , vol. 39, # 14 p. 2856 - 2859 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| chlorotrifluoromethylimidazopyridine |