1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine structure
|
Common Name | 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1785-17-7 | Molecular Weight | 443.13500 | |
| Density | 1.73g/cm3 | Boiling Point | 572.6ºC at 760 mmHg | |
| Molecular Formula | C19H13Br2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.1ºC | |
| Name | 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 572.6ºC at 760 mmHg |
| Molecular Formula | C19H13Br2N3 |
| Molecular Weight | 443.13500 |
| Flash Point | 300.1ºC |
| Exact Mass | 440.94800 |
| PSA | 50.74000 |
| LogP | 7.36160 |
| Vapour Pressure | 4.06E-13mmHg at 25°C |
| Index of Refraction | 1.739 |
| InChIKey | CBCIPUKBHDNHAL-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc2c(c1Br)Cc1cc(N=Nc3ccccc3)ccc1-2 |
|
~%
1,3-dibromo-7-p... CAS#:1785-17-7 |
| Literature: Pan; Fletcher Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 491 - 497 |
|
~%
1,3-dibromo-7-p... CAS#:1785-17-7 |
| Literature: Pan; Fletcher Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 491 - 497 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Amino-1,3-dibrom-7-phenylazo-fluoren |