1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine
1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine structure
|
Common Name | 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1785-17-7 | Molecular Weight | 443.13500 | |
| Density | 1.73g/cm3 | Boiling Point | 572.6ºC at 760 mmHg | |
| Molecular Formula | C19H13Br2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 572.6ºC at 760 mmHg |
| Molecular Formula | C19H13Br2N3 |
| Molecular Weight | 443.13500 |
| Flash Point | 300.1ºC |
| Exact Mass | 440.94800 |
| PSA | 50.74000 |
| LogP | 7.36160 |
| Vapour Pressure | 4.06E-13mmHg at 25°C |
| Index of Refraction | 1.739 |
| InChIKey | CBCIPUKBHDNHAL-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc2c(c1Br)Cc1cc(N=Nc3ccccc3)ccc1-2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,3-dibromo-7-p... CAS#:1785-17-7 |
| Literature: Pan; Fletcher Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 491 - 497 |
|
~%
1,3-dibromo-7-p... CAS#:1785-17-7 |
| Literature: Pan; Fletcher Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 491 - 497 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Amino-1,3-dibrom-7-phenylazo-fluoren |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine? |
| A: Polar surface area (PSA) of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine is 50.74000. |
| Q: What is the SMILES notation of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine? |
| A: SMILES notation of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine is Nc1c(Br)cc2c(c1Br)Cc1cc(N=Nc3ccccc3)ccc1-2. |
| Q: What are the upstream materials of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine? |
| A: Related upstream materials(CAS) of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine: 892-61-5;1785-57-5;586-96-9. |
| Q: What is the CAS number of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine? |
| A: CAS number of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine is 1785-17-7. |
| Q: What is the Chinese name of 1785-17-7? |
| A: Chinese name of 1785-17-7 is 1785-17-7. |
| Q: What is the molecular formula of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine? |
| A: Molecular formula of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine is C19H13Br2N3. |
| Q: What English synonyms does 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine have? |
| A: English synonyms of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine: 2-Amino-1,3-dibrom-7-phenylazo-fluoren. |
| Q: What is the InChIKey of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine? |
| A: InChIKey of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine is CBCIPUKBHDNHAL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine? |
| A: Molecular weight of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine is 443.13500. |
| Q: What is the English name of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine? |
| A: The English name of 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine is 1,3-dibromo-7-phenyldiazenyl-9H-fluoren-2-amine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |