Acetamide,N-(1,3,4,7-tetrachloro-9H-fluoren-2-yl)- structure
|
Common Name | Acetamide,N-(1,3,4,7-tetrachloro-9H-fluoren-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 1785-21-3 | Molecular Weight | 361.05000 | |
| Density | 1.575g/cm3 | Boiling Point | 537.7ºC at 760mmHg | |
| Molecular Formula | C15H9Cl4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279ºC | |
| Name | N-(1,3,4,7-tetrachloro-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.575g/cm3 |
|---|---|
| Boiling Point | 537.7ºC at 760mmHg |
| Molecular Formula | C15H9Cl4NO |
| Molecular Weight | 361.05000 |
| Flash Point | 279ºC |
| Exact Mass | 358.94400 |
| PSA | 29.10000 |
| LogP | 5.90280 |
| Vapour Pressure | 1.24E-11mmHg at 25°C |
| Index of Refraction | 1.69 |
| InChIKey | WQRUPKUYVMSSBU-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(Cl)c(Cl)c2c(c1Cl)Cc1cc(Cl)ccc1-2 |
| HS Code | 2924299090 |
|---|
|
~%
Acetamide,N-(1,... CAS#:1785-21-3 |
| Literature: Pan; Fletcher Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 491 - 497 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Acetamino-1,3,4,7-tetrachlor-fluoren |
| HMS3089B21 |