Acetamide,N-(3-bromo-7-nitro-9-oxo-9H-fluoren-2-yl)-2,2,2-trifluoro
Acetamide,N-(3-bromo-7-nitro-9-oxo-9H-fluoren-2-yl)-2,2,2-trifluoro structure
|
Common Name | Acetamide,N-(3-bromo-7-nitro-9-oxo-9H-fluoren-2-yl)-2,2,2-trifluoro | ||
|---|---|---|---|---|
| CAS Number | 1785-26-8 | Molecular Weight | 415.11800 | |
| Density | 1.867g/cm3 | Boiling Point | 564.2ºC at 760mmHg | |
| Molecular Formula | C15H6BrF3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.867g/cm3 |
|---|---|
| Boiling Point | 564.2ºC at 760mmHg |
| Molecular Formula | C15H6BrF3N2O4 |
| Molecular Weight | 415.11800 |
| Flash Point | 295ºC |
| Exact Mass | 413.94600 |
| PSA | 91.99000 |
| LogP | 4.66570 |
| Vapour Pressure | 9.44E-13mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | QVRNQSYEJCXCRS-UHFFFAOYSA-N |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2-c2cc(Br)c(NC(=O)C(F)(F)F)cc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Acetamide,N-(3-... CAS#:1785-26-8 |
| Literature: Pan,H.-L.; Fletcher,T.L. J. Med. Chem., 1964 , vol. 7, p. 31 - 38 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:91821-77-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide? |
| A: CAS number of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide is 1785-26-8. |
| Q: What is the polar surface area (PSA) of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide? |
| A: Polar surface area (PSA) of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide is 91.99000. |
| Q: What are the downstream products of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide? |
| A: Related downstream products(CAS) of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide: 91821-77-1. |
| Q: What is the Chinese name of 1785-26-8? |
| A: Chinese name of 1785-26-8 is 1785-26-8. |
| Q: What is the LogP of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide? |
| A: LogP of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide is 4.66570. |
| Q: What is the English name of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide? |
| A: The English name of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide is N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide. |
| Q: What is the boiling point of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide? |
| A: Boiling point of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide is 564.2ºC at 760mmHg. |
| Q: What is the SMILES notation of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide? |
| A: SMILES notation of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide is O=C1c2cc([N+](=O)[O-])ccc2-c2cc(Br)c(NC(=O)C(F)(F)F)cc21. |
| Q: What is the InChIKey of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide? |
| A: InChIKey of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide is QVRNQSYEJCXCRS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide? |
| A: Molecular formula of N-(3-bromo-7-nitro-9-oxofluoren-2-yl)-2,2,2-trifluoroacetamide is C15H6BrF3N2O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |