4-chloro-9H-fluoren-2-amine structure
|
Common Name | 4-chloro-9H-fluoren-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1785-37-1 | Molecular Weight | 215.67800 | |
| Density | 1.326g/cm3 | Boiling Point | 420.7ºC at 760 mmHg | |
| Molecular Formula | C13H10ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.2ºC | |
| Name | 4-chloro-9H-fluoren-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 420.7ºC at 760 mmHg |
| Molecular Formula | C13H10ClN |
| Molecular Weight | 215.67800 |
| Flash Point | 208.2ºC |
| Exact Mass | 215.05000 |
| PSA | 26.02000 |
| LogP | 4.07460 |
| Vapour Pressure | 2.76E-07mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | QNFQLVJHTBDKGC-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c2c(c1)Cc1ccccc1-2 |
|
~%
4-chloro-9H-flu... CAS#:1785-37-1 |
| Literature: Pan; Fletcher Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 491 - 497 |
|
~%
4-chloro-9H-flu... CAS#:1785-37-1 |
| Literature: Pan; Fletcher Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 491 - 497 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Amino-4-chlor-fluoren |