(2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol
Modify Date: 2025-09-10 08:08:53
(2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol structure
|
Common Name | (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol | ||
|---|---|---|---|---|
| CAS Number | 1786428-86-1 | Molecular Weight | 335.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Cl2N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12Cl2N6O3 |
|---|---|
| Molecular Weight | 335.14 |
| InChIKey | ZJOZWOUCVIGZMP-TWOGKDBTSA-N |
| SMILES | Nc1nc(N)c2ncn(C3OC(CO)C(O)C3(Cl)Cl)c2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol? |
| A: InChIKey of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol is ZJOZWOUCVIGZMP-TWOGKDBTSA-N. |
| Q: What is the English name of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol? |
| A: The English name of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol is (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol. |
| Q: What is the SMILES notation of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol? |
| A: SMILES notation of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol is Nc1nc(N)c2ncn(C3OC(CO)C(O)C3(Cl)Cl)c2n1. |
| Q: What is the Chinese name of 1786428-86-1? |
| A: Chinese name of 1786428-86-1 is 1786428-86-1. |
| Q: What is the molecular formula of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol? |
| A: Molecular formula of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol is C10H12Cl2N6O3. |
| Q: What is the molecular weight of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol? |
| A: Molecular weight of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol is 335.14. |
| Q: What is the CAS number of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol? |
| A: CAS number of (2R,3R,5R)-4,4-Dichloro-5-(2,6-diamino-9H-purin-9-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol is 1786428-86-1. |