bis[[methoxy(dimethyl)silyl]oxy]-dimethylsilane structure
|
Common Name | bis[[methoxy(dimethyl)silyl]oxy]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 17866-01-2 | Molecular Weight | 268.53000 | |
| Density | 0.916g/cm3 | Boiling Point | 192.311ºC at 760 mmHg | |
| Molecular Formula | C8H24O4Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 62.036ºC | |
| Name | bis[[methoxy(dimethyl)silyl]oxy]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.916g/cm3 |
|---|---|
| Boiling Point | 192.311ºC at 760 mmHg |
| Molecular Formula | C8H24O4Si3 |
| Molecular Weight | 268.53000 |
| Flash Point | 62.036ºC |
| Exact Mass | 268.09800 |
| PSA | 36.92000 |
| LogP | 2.41780 |
| Vapour Pressure | 0.685mmHg at 25°C |
| Index of Refraction | 1.407 |
| InChIKey | LWBUOUJYDAMWCB-UHFFFAOYSA-N |
| SMILES | CO[Si](C)(C)O[Si](C)(C)O[Si](C)(C)OC |
|
~%
bis[[methoxy(di... CAS#:17866-01-2 |
| Literature: Lasocki Roczniki Chemii, 1957 , vol. 31, p. 837,839,840 Chem.Abstr., 1958 , p. 10005 |
|
~%
bis[[methoxy(di... CAS#:17866-01-2 |
| Literature: Tanaka; Okawara Bulletin of the Chemical Society of Japan, 1955 , vol. 28, p. 364 |
|
~%
bis[[methoxy(di... CAS#:17866-01-2 |
| Literature: Lasocki, Zygmunt; Witekowa, Malgorzata Journal of Organometallic Chemistry, 1984 , vol. 264, # 1-2 p. 49 - 60 |
| 1,5-dimethoxyhexamethyltrisiloxane |
| 1,5-Dimethoxy-hexamethyl-trisiloxan |
| Trisiloxane,1,5-dimethoxy-1,1,3,3,5,5-hexamethyl |
| 1,5-dimethoxy-1,1,3,3,5,5-hexamethyl-trisiloxane |