(S)-N-[2-(2,3-Dihydro-6-methoxy-1H-inden-1-yl)ethyl]propanamide
![(S)-N-[2-(2,3-Dihydro-6-methoxy-1H-inden-1-yl)ethyl]propanamide Structure](https://image.chemsrc.com/caspic/101/178678-16-5.png)
(S)-N-[2-(2,3-Dihydro-6-methoxy-1H-inden-1-yl)ethyl]propanamide structure
|
Common Name | (S)-N-[2-(2,3-Dihydro-6-methoxy-1H-inden-1-yl)ethyl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 178678-16-5 | Molecular Weight | 247.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21NO2 |
|---|---|
| Molecular Weight | 247.33300 |
| Exact Mass | 247.15700 |
| PSA | 41.82000 |
| LogP | 3.48160 |
| InChIKey | BURWKXUNJOXCGV-LBPRGKRZSA-N |
| SMILES | CCC(=O)NCCC1CCc2ccc(OC)cc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
![(E)-N-[2-(2,3-Dihydro-6-methoxy-1H-inden-1-ylidene)ethyl]propanamide Structure](https://image.chemsrc.com/caspic/292/196597-82-7.png)
CAS#:196597-82-7
CAS#:13623-25-1
CAS#:187871-98-3
CAS#:178676-73-8
CAS#:468104-14-5
CAS#:178677-36-6
CAS#:123-62-6![2-[(1S)-6-Methoxy-2,3-dihydro-1H-inden-1-yl]ethanamine Structure](https://image.chemsrc.com/caspic/200/181996-53-2.png)
CAS#:181996-53-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide? |
| A: SMILES notation of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide is CCC(=O)NCCC1CCc2ccc(OC)cc21. |
| Q: What is the English name of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide? |
| A: The English name of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide is N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide. |
| Q: What are the upstream materials of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide? |
| A: Related upstream materials(CAS) of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide: 196597-82-7;13623-25-1;187871-98-3;178676-73-8;468104-14-5;178677-36-6;123-62-6;181996-53-2. |
| Q: What is the LogP of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide? |
| A: LogP of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide is 3.48160. |
| Q: What is the CAS number of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide? |
| A: CAS number of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide is 178678-16-5. |
| Q: What is the polar surface area (PSA) of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide? |
| A: Polar surface area (PSA) of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide is 41.82000. |
| Q: What is the InChIKey of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide? |
| A: InChIKey of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide is BURWKXUNJOXCGV-LBPRGKRZSA-N. |
| Q: What is the molecular weight of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide? |
| A: Molecular weight of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide is 247.33300. |
| Q: What is the molecular formula of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide? |
| A: Molecular formula of N-[2-[(1S)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethyl]propanamide is C15H21NO2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |