1-amino-4-hydroxy-2-(2-hydroxyethoxy)anthraquinone structure
|
Common Name | 1-amino-4-hydroxy-2-(2-hydroxyethoxy)anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 17869-07-7 | Molecular Weight | 299.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-4-hydroxy-2-(2'-hydroxyethoxy)-anthraquinone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO5 |
|---|---|
| Molecular Weight | 299.27800 |
| Exact Mass | 299.07900 |
| PSA | 109.85000 |
| LogP | 1.70210 |
| Vapour Pressure | 5.53E-17mmHg at 25°C |
| InChIKey | YNSMMVQJQULRFZ-UHFFFAOYSA-N |
| SMILES | Nc1c(OCCO)cc(O)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-amino-4-hydroxy-2-(2-hydroxyethyl)oxyanthraquinone |