2-Naphthalenecarboxylic acid, 7-bromo-4-hydroxy-, ethyl ester structure
|
Common Name | 2-Naphthalenecarboxylic acid, 7-bromo-4-hydroxy-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 178876-99-8 | Molecular Weight | 295.12900 | |
| Density | 1.533g/cm3 | Boiling Point | 450.24ºC at 760 mmHg | |
| Molecular Formula | C13H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.098ºC | |
| Name | Ethyl 7-bromo-4-hydroxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.533g/cm3 |
|---|---|
| Boiling Point | 450.24ºC at 760 mmHg |
| Molecular Formula | C13H11BrO3 |
| Molecular Weight | 295.12900 |
| Flash Point | 226.098ºC |
| Exact Mass | 293.98900 |
| PSA | 46.53000 |
| LogP | 3.48460 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | VEWIXWCOUVXFFG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(O)c2ccc(Br)cc2c1 |
| Storage condition | 2-8°C, stored under nitrogen |
|
~99%
2-Naphthaleneca... CAS#:178876-99-8 |
| Literature: Journal of Organic Chemistry, , vol. 61, # 15 p. 4894 - 4912 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| ethyl 4-hydroxy-7-bromo-2-naphthoate |
| ethyl 7-bromo-3-hydroxy-2-naphthoate |
| ethyl 7-bromo-3-hydroxynaphthalen-2-carboxylate |
| ethyl 7-Bromo-4-hydroxy-2-naphthalenecarboxylate |