[1-methyl-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methanol structure
|
Common Name | [1-methyl-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 178979-03-8 | Molecular Weight | 307.36800 | |
| Density | 1.33g/cm3 | Boiling Point | 487.5ºC at 760 mmHg | |
| Molecular Formula | C14H17N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.6ºC | |
| Name | [1-methyl-5-(3-nitrophenyl)sulfanyl-4-propan-2-ylimidazol-2-yl]methanol |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 487.5ºC at 760 mmHg |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.36800 |
| Flash Point | 248.6ºC |
| Exact Mass | 307.09900 |
| PSA | 109.17000 |
| LogP | 3.61840 |
| Vapour Pressure | 2.56E-10mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | VTHJXLCUDZONMG-UHFFFAOYSA-N |
| SMILES | CC(C)c1nc(CO)n(C)c1Sc1cccc([N+](=O)[O-])c1 |
|
~%
[1-methyl-5-(3-... CAS#:178979-03-8 |
| Literature: Shionogi and Co., Ltd. Patent: US5910506 A1, 1999 ; |