1-[5-(3,5-dichlorophenyl)sulfanyl-2-(hydroxymethyl)-4-propan-2-ylimidazol-1-yl]-2-methylpropan-2-ol structure
|
Common Name | 1-[5-(3,5-dichlorophenyl)sulfanyl-2-(hydroxymethyl)-4-propan-2-ylimidazol-1-yl]-2-methylpropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 178980-48-8 | Molecular Weight | 389.34000 | |
| Density | 1.32g/cm3 | Boiling Point | 551ºC at 760 mmHg | |
| Molecular Formula | C17H22Cl2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287ºC | |
| Name | 1-[5-(3,5-dichlorophenyl)sulfanyl-2-(hydroxymethyl)-4-propan-2-ylimidazol-1-yl]-2-methylpropan-2-ol |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 551ºC at 760 mmHg |
| Molecular Formula | C17H22Cl2N2O2S |
| Molecular Weight | 389.34000 |
| Flash Point | 287ºC |
| Exact Mass | 388.07800 |
| PSA | 83.58000 |
| LogP | 4.72770 |
| Vapour Pressure | 5.63E-13mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | HUDHUNCDOYEPGH-UHFFFAOYSA-N |
| SMILES | CC(C)c1nc(CO)n(CC(C)(C)O)c1Sc1cc(Cl)cc(Cl)c1 |
|
~0%
1-[5-(3,5-dichl... CAS#:178980-48-8 |
| Literature: Shionogi and Co., Ltd. Patent: US5910506 A1, 1999 ; |