1,2-Benzenedicarboxamide,N1,N2-bis[(trimethylsilyl)methyl]- structure
|
Common Name | 1,2-Benzenedicarboxamide,N1,N2-bis[(trimethylsilyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 17899-13-7 | Molecular Weight | 336.57700 | |
| Density | 0.988g/cm3 | Boiling Point | 483.5ºC at 760mmHg | |
| Molecular Formula | C16H28N2O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.2ºC | |
| Name | 1-N,2-N-bis(trimethylsilylmethyl)benzene-1,2-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.988g/cm3 |
|---|---|
| Boiling Point | 483.5ºC at 760mmHg |
| Molecular Formula | C16H28N2O2Si2 |
| Molecular Weight | 336.57700 |
| Flash Point | 246.2ºC |
| Exact Mass | 336.16900 |
| PSA | 58.20000 |
| LogP | 4.51940 |
| Vapour Pressure | 1.67E-09mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | IVWZSXHLDVAFQC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CNC(=O)c1ccccc1C(=O)NC[Si](C)(C)C |
|
~%
1,2-Benzenedica... CAS#:17899-13-7 |
| Literature: Fessenden,R.J. et al. Journal of Organic Chemistry, 1962 , vol. 27, p. 1485 - 1486 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-Bis-(trimethylsilylmethyl)-phthalamid |
| n,n'-bis[(trimethylsilyl)methyl]benzene-1,2-dicarboxamide |