2,5,7,10-Tetraoxa-6-silaundecane,6-(2-methoxyethoxy)-6-phenyl- structure
|
Common Name | 2,5,7,10-Tetraoxa-6-silaundecane,6-(2-methoxyethoxy)-6-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 17903-05-8 | Molecular Weight | 330.44900 | |
| Density | 1.06g/cm3 | Boiling Point | 352.5ºC at 760mmHg | |
| Molecular Formula | C15H26O6Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.7ºC | |
| Name | tris(2-methoxyethoxy)-phenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 352.5ºC at 760mmHg |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.44900 |
| Flash Point | 135.7ºC |
| Exact Mass | 330.15000 |
| PSA | 55.38000 |
| LogP | 0.82150 |
| Vapour Pressure | 7.75E-05mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | DBXDLSPMDNQBBQ-UHFFFAOYSA-N |
| SMILES | COCCO[Si](OCCOC)(OCCOC)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| tris-(2-methoxy-ethoxy)-phenyl-silane |
| 2,5,7,10-Tetraoxa-6-silaundecane,6-(2-methoxyethoxy)-6-phenyl |
| Silane,tris(2-methoxyethoxy)phenyl |
| Phenyltris(methoxyethoxy)silane |
| phenyl-tris(1,4-dioxapentyl) silane |
| Tris-(2-methoxy-aethoxy)-phenyl-silan |
| phenyltrimethoxyethoxysilane |
| 6-(2-Methoxyethoxy)-6-phenyl-2,5,7,10-tetraoxa-6-silaundecane |