Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl
Modify Date: 2026-07-18 18:31:29
![Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl Structure](https://www.chemsrc.com/extcaspic/122/1790361-97-5.png)
Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl structure
|
Common Name | Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 1790361-97-5 | Molecular Weight | 291.80 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18ClN3O2S |
|---|---|
| Molecular Weight | 291.80 |
| InChIKey | CTLXMVWQNKCWHL-UHFFFAOYSA-N |
| SMILES | CN(CCNS(=O)(=O)N(C)C)c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl? |
| A: InChIKey of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl is CTLXMVWQNKCWHL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl? |
| A: Molecular weight of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl is 291.80. |
| Q: What is the Chinese name of 1790361-97-5? |
| A: Chinese name of 1790361-97-5 is 1790361-97-5. |
| Q: What is the CAS number of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl? |
| A: CAS number of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl is 1790361-97-5. |
| Q: What is the molecular formula of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl? |
| A: Molecular formula of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl is C11H18ClN3O2S. |
| Q: What is the SMILES notation of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl? |
| A: SMILES notation of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl is CN(CCNS(=O)(=O)N(C)C)c1ccc(Cl)cc1. |
| Q: What is the English name of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl? |
| A: The English name of Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl is Sulfamide, Na(2)-[2-[(4-chlorophenyl)methylamino]ethyl]-N,N-dimethyl. |