1-Cyclohexene-1-carboxylic acid, 4-(1,5-dimethyl-3-oxohexyl)-, methyl ester, (1R,4R)-(+)- structure
|
Common Name | 1-Cyclohexene-1-carboxylic acid, 4-(1,5-dimethyl-3-oxohexyl)-, methyl ester, (1R,4R)-(+)- | ||
|---|---|---|---|---|
| CAS Number | 17904-27-7 | Molecular Weight | 266.37600 | |
| Density | 0.995g/cm3 | Boiling Point | 351.9ºC at 760mmHg | |
| Molecular Formula | C16H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.4ºC | |
| Name | methyl (4R)-4-[(2R)-6-methyl-4-oxoheptan-2-yl]cyclohexene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 351.9ºC at 760mmHg |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.37600 |
| Flash Point | 150.4ºC |
| Exact Mass | 266.18800 |
| PSA | 43.37000 |
| LogP | 3.52730 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | IIWNDLDEVPJIBT-OLZOCXBDSA-N |
| SMILES | COC(=O)C1=CCC(C(C)CC(=O)CC(C)C)CC1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| CPD-8837 |
| Methyltodomatuat |