Cylindrin structure
|
Common Name | Cylindrin | ||
|---|---|---|---|---|
| CAS Number | 17904-55-1 | Molecular Weight | 440.74400 | |
| Density | 0.98g/cm3 | Boiling Point | 484.9ºC at 760mmHg | |
| Molecular Formula | C31H52O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.4ºC | |
Use of CylindrinCylindrin is a natural product that can be found in Diospyros nigra[1]. |
| Name | (3S,3aS,5aS,5bS,7aR,9S,11aS,13aR,13bS)-3-Isopropyl-9-methoxy-3a,5 a,8,8,11a,13a-hexamethyl-2,3,3a,4,5,5a,5b,6,7,7a,8,9,10,11,11a,13 ,13a,13b-octadecahydro-1H-cyclopenta[a]chrysene |
|---|---|
| Synonym | More Synonyms |
| Description | Cylindrin is a natural product that can be found in Diospyros nigra[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 484.9ºC at 760mmHg |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.74400 |
| Flash Point | 248.4ºC |
| Exact Mass | 440.40200 |
| PSA | 9.23000 |
| LogP | 8.67890 |
| Vapour Pressure | 4.35E-09mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | MRNPHCMRIQYRFU-UWAWSDATSA-N |
| SMILES | COC1CCC2(C)C3=CCC4(C)C5CCC(C(C)C)C5(C)CCC4(C)C3CCC2C1(C)C |
| Isoarborinol-methylester |
| Isoapoptolidin |
| isoarborinol methyl ether |
| isoapoptolidin A |
| Cylindrin |