Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine
Modify Date: 2026-07-20 16:19:53
![Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine Structure](https://www.chemsrc.com/extcaspic/130/179056-31-6.png)
Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine structure
|
Common Name | Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine | ||
|---|---|---|---|---|
| CAS Number | 179056-31-6 | Molecular Weight | 306.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H22N4 |
|---|---|
| Molecular Weight | 306.4 |
| InChIKey | DKSZPSQAOOONHG-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(CNCc2cccc(-c3ccn[nH]3)c2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine? |
| A: Molecular weight of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine is 306.4. |
| Q: What is the SMILES notation of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine? |
| A: SMILES notation of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine is CN(C)c1ccc(CNCc2cccc(-c3ccn[nH]3)c2)cc1. |
| Q: What is the Chinese name of 179056-31-6? |
| A: Chinese name of 179056-31-6 is 179056-31-6. |
| Q: What is the CAS number of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine? |
| A: CAS number of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine is 179056-31-6. |
| Q: What is the InChIKey of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine? |
| A: InChIKey of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine is DKSZPSQAOOONHG-UHFFFAOYSA-N. |
| Q: What is the English name of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine? |
| A: The English name of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine is Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine. |
| Q: What is the molecular formula of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine? |
| A: Molecular formula of Dimethyl-(4-{[3-(2H-pyrazol-3-yl)-benzylamino]-methyl}-phenyl)-amine is C19H22N4. |