Methyl 4-(1-methyl-1H-pyrazol-5-yl)benzoate structure
|
Common Name | Methyl 4-(1-methyl-1H-pyrazol-5-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 179057-12-6 | Molecular Weight | 216.236 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 357.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.0±23.2 °C | |
| Name | methyl 4-(2-methylpyrazol-3-yl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.5±25.0 °C at 760 mmHg |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.236 |
| Flash Point | 170.0±23.2 °C |
| Exact Mass | 216.089874 |
| PSA | 44.12000 |
| LogP | 1.94 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | PYEWEFGLTSTRFG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(-c2ccnn2C)cc1 |
| HS Code | 2933199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 4-(1-methyl-1H-pyrazol-5-yl)benzoate |
| Benzoic acid, 4-(1-methyl-1H-pyrazol-5-yl)-, methyl ester |