tributoxy(propyl)silane structure
|
Common Name | tributoxy(propyl)silane | ||
|---|---|---|---|---|
| CAS Number | 17906-22-8 | Molecular Weight | 290.51400 | |
| Density | 0.877g/cm3 | Boiling Point | 234.9ºC at 760 mmHg | |
| Molecular Formula | C15H34O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.6ºC | |
| Name | tributoxy(propyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.877g/cm3 |
|---|---|
| Boiling Point | 234.9ºC at 760 mmHg |
| Molecular Formula | C15H34O3Si |
| Molecular Weight | 290.51400 |
| Flash Point | 108.6ºC |
| Exact Mass | 290.22800 |
| PSA | 27.69000 |
| LogP | 4.78540 |
| Vapour Pressure | 0.0787mmHg at 25°C |
| Index of Refraction | 1.429 |
| InChIKey | WAAWAIHPWOJHJJ-UHFFFAOYSA-N |
| SMILES | CCCCO[Si](CCC)(OCCCC)OCCCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 241-849-9 |
| tributoxy-propyl-silane |
| propyltributoxysilane |